C20H22FNO2 — CID 108795547
N-(2,6-diethylphenyl)-4-(4-fluorophenyl)-4-oxobutanamide (PubChem CID 108795547) has the molecular formula C20H22FNO2 and a molecular weight of 327.40 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-4-(4-fluorophenyl)-4-oxobutanamide.
| Compound Name | N-(2,6-diethylphenyl)-4-(4-fluorophenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 108795547 |
| Molecular Formula | C20H22FNO2 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N-(2,6-diethylphenyl)-4-(4-fluorophenyl)-4-oxobutanamide |
| SMILES | CCc1cccc(CC)c1NC(=O)CCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H22FNO2/c1-3-14-6-5-7-15(4-2)20(14)22-19(24)13-12-18(23)16-8-10-17(21)11-9-16/h5-11H,3-4,12-13H2,1-2H3,(H,22,24) |
| InChIKey | OSVXWDLORXJNHU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |