C20H25FN2O — CID 109000450
N-(2,6-diethylphenyl)-2-[2-(4-fluorophenyl)ethylamino]acetamide (PubChem CID 109000450) has the molecular formula C20H25FN2O and a molecular weight of 328.43 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2-[2-(4-fluorophenyl)ethylamino]acetamide.
| Compound Name | N-(2,6-diethylphenyl)-2-[2-(4-fluorophenyl)ethylamino]acetamide |
|---|---|
| PubChem CID | 109000450 |
| Molecular Formula | C20H25FN2O |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | N-(2,6-diethylphenyl)-2-[2-(4-fluorophenyl)ethylamino]acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)CNCCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H25FN2O/c1-3-16-6-5-7-17(4-2)20(16)23-19(24)14-22-13-12-15-8-10-18(21)11-9-15/h5-11,22H,3-4,12-14H2,1-2H3,(H,23,24) |
| InChIKey | SKYULUKSSQGZHF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|