C17H18F2N2O2 — CID 109001267
N-(2,6-difluorophenyl)-2-[2-(4-methoxyphenyl)ethylamino]acetamide (PubChem CID 109001267) has the molecular formula C17H18F2N2O2 and a molecular weight of 320.34 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-[2-(4-methoxyphenyl)ethylamino]acetamide.
| Compound Name | N-(2,6-difluorophenyl)-2-[2-(4-methoxyphenyl)ethylamino]acetamide |
|---|---|
| PubChem CID | 109001267 |
| Molecular Formula | C17H18F2N2O2 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-[2-(4-methoxyphenyl)ethylamino]acetamide |
| SMILES | COc1ccc(CCNCC(=O)Nc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C17H18F2N2O2/c1-23-13-7-5-12(6-8-13)9-10-20-11-16(22)21-17-14(18)3-2-4-15(17)19/h2-8,20H,9-11H2,1H3,(H,21,22) |
| InChIKey | PARZIRBJGJVENP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|