C11H11F4N3O2 — CID 77099519
4,4,4-trifluoro-N-[4-fluoro-3-(N'-hydroxycarbamimidoyl)phenyl]butanamide (PubChem CID 77099519) has the molecular formula C11H11F4N3O2 and a molecular weight of 293.22 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[4-fluoro-3-(N'-hydroxycarbamimidoyl)phenyl]butanamide.
| Compound Name | 4,4,4-trifluoro-N-[4-fluoro-3-(N'-hydroxycarbamimidoyl)phenyl]butanamide |
|---|---|
| PubChem CID | 77099519 |
| Molecular Formula | C11H11F4N3O2 |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 4,4,4-trifluoro-N-[4-fluoro-3-(N'-hydroxycarbamimidoyl)phenyl]butanamide |
| SMILES | NC(=NO)c1cc(NC(=O)CCC(F)(F)F)ccc1F |
| InChI | InChI=1S/C11H11F4N3O2/c12-8-2-1-6(5-7(8)10(16)18-20)17-9(19)3-4-11(13,14)15/h1-2,5,20H,3-4H2,(H2,16,18)(H,17,19) |
| InChIKey | IAROHAJONJUVSZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|