About 2-fluoro-N'-hydroxy-5-(sulfamoylamino)benzenecarboximidamide
2-fluoro-N'-hydroxy-5-(sulfamoylamino)benzenecarboximidamide (PubChem CID 114959563) has the molecular formula C7H9FN4O3S
and a molecular weight of 248.24 g/mol. Its IUPAC name is 2-fluoro-N'-hydroxy-5-(sulfamoylamino)benzenecarboximidamide.
Molecular Properties
| Compound Name | 2-fluoro-N'-hydroxy-5-(sulfamoylamino)benzenecarboximidamide |
| PubChem CID | 114959563 |
| Molecular Formula | C7H9FN4O3S |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 2-fluoro-N'-hydroxy-5-(sulfamoylamino)benzenecarboximidamide |
| SMILES | N/C(=N/O)c1cc(NS(N)(=O)=O)ccc1F |
| InChI | InChI=1S/C7H9FN4O3S/c8-6-2-1-4(12-16(10,14)15)3-5(6)7(9)11-13/h1-3,12-13H,(H2,9,11)(H2,10,14,15) |
| InChIKey | CSAZASSNUQSKOP-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N'-hydroxy-5-(sulfamoylamino)benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N'-hydroxy-5-(sulfamoylamino)benzenecarboximidamide?
The IUPAC name of 2-fluoro-N'-hydroxy-5-(sulfamoylamino)benzenecarboximidamide (CID 114959563) is 2-fluoro-N'-hydroxy-5-(sulfamoylamino)benzenecarboximidamide.
What is the SMILES notation for 2-fluoro-N'-hydroxy-5-(sulfamoylamino)benzenecarboximidamide?
The canonical SMILES for 2-fluoro-N'-hydroxy-5-(sulfamoylamino)benzenecarboximidamide is N/C(=N/O)c1cc(NS(N)(=O)=O)ccc1F.
What is the InChIKey of 2-fluoro-N'-hydroxy-5-(sulfamoylamino)benzenecarboximidamide?
The InChIKey is CSAZASSNUQSKOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9FN4O3S/c8-6-2-1-4(12-16(10,14)15)3-5(6)7(9)11-13/h1-3,12-13H,(H2,9,11)(H2,10,14,15).
What are the key properties of 2-fluoro-N'-hydroxy-5-(sulfamoylamino)benzenecarboximidamide?
2-fluoro-N'-hydroxy-5-(sulfamoylamino)benzenecarboximidamide has a molecular weight of 248.24 g/mol, XLogP of -0.46, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N'-hydroxy-5-(sulfamoylamino)benzenecarboximidamide is sourced from PubChem (CID 114959563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).