C11H15FN4O2 — CID 76939353
1-[4-fluoro-3-(N'-hydroxycarbamimidoyl)phenyl]-3-propylurea (PubChem CID 76939353) has the molecular formula C11H15FN4O2 and a molecular weight of 254.27 g/mol. Its IUPAC name is 1-[4-fluoro-3-(N'-hydroxycarbamimidoyl)phenyl]-3-propylurea.
| Compound Name | 1-[4-fluoro-3-(N'-hydroxycarbamimidoyl)phenyl]-3-propylurea |
|---|---|
| PubChem CID | 76939353 |
| Molecular Formula | C11H15FN4O2 |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1-[4-fluoro-3-(N'-hydroxycarbamimidoyl)phenyl]-3-propylurea |
| SMILES | CCCNC(=O)Nc1ccc(F)c(C(N)=NO)c1 |
| InChI | InChI=1S/C11H15FN4O2/c1-2-5-14-11(17)15-7-3-4-9(12)8(6-7)10(13)16-18/h3-4,6,18H,2,5H2,1H3,(H2,13,16)(H2,14,15,17) |
| InChIKey | FDFLFDTXWXETTM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|