C12H8Br2FN3O2S — CID 107965169
2,5-dibromo-N-[4-fluoro-3-[(E)-N'-hydroxycarbamimidoyl]phenyl]thiophene-3-carboxamide (PubChem CID 107965169) has the molecular formula C12H8Br2FN3O2S and a molecular weight of 437.09 g/mol. Its IUPAC name is 2,5-dibromo-N-[4-fluoro-3-[(E)-N'-hydroxycarbamimidoyl]phenyl]thiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-[4-fluoro-3-[(E)-N'-hydroxycarbamimidoyl]phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 107965169 |
| Molecular Formula | C12H8Br2FN3O2S |
| Molecular Weight | 437.09 g/mol |
| Exact Mass | 434.87 |
| IUPAC Name | 2,5-dibromo-N-[4-fluoro-3-[(E)-N'-hydroxycarbamimidoyl]phenyl]thiophene-3-carboxamide |
| SMILES | N/C(=N/O)c1cc(NC(=O)c2cc(Br)sc2Br)ccc1F |
| InChI | InChI=1S/C12H8Br2FN3O2S/c13-9-4-7(10(14)21-9)12(19)17-5-1-2-8(15)6(3-5)11(16)18-20/h1-4,20H,(H2,16,18)(H,17,19) |
| InChIKey | WONFXMMKXGVVRK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.09 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|