C12H10FN5O2 — CID 136905916
N-[4-fluoro-3-[(E)-N'-hydroxycarbamimidoyl]phenyl]pyridazine-4-carboxamide (PubChem CID 136905916) has the molecular formula C12H10FN5O2 and a molecular weight of 275.24 g/mol. Its IUPAC name is N-[4-fluoro-3-[(E)-N'-hydroxycarbamimidoyl]phenyl]pyridazine-4-carboxamide.
| Compound Name | N-[4-fluoro-3-[(E)-N'-hydroxycarbamimidoyl]phenyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 136905916 |
| Molecular Formula | C12H10FN5O2 |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | N-[4-fluoro-3-[(E)-N'-hydroxycarbamimidoyl]phenyl]pyridazine-4-carboxamide |
| SMILES | N/C(=N/O)c1cc(NC(=O)c2ccnnc2)ccc1F |
| InChI | InChI=1S/C12H10FN5O2/c13-10-2-1-8(5-9(10)11(14)18-20)17-12(19)7-3-4-15-16-6-7/h1-6,20H,(H2,14,18)(H,17,19) |
| InChIKey | JRJWUWIIBUSTKU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 113.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|