C14H14FN3O2S — CID 79975885
3-ethyl-N-[4-fluoro-3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]thiophene-2-carboxamide (PubChem CID 79975885) has the molecular formula C14H14FN3O2S and a molecular weight of 307.35 g/mol. Its IUPAC name is 3-ethyl-N-[4-fluoro-3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | 3-ethyl-N-[4-fluoro-3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 79975885 |
| Molecular Formula | C14H14FN3O2S |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 3-ethyl-N-[4-fluoro-3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]thiophene-2-carboxamide |
| SMILES | CCc1ccsc1C(=O)Nc1ccc(F)c(/C(N)=N/O)c1 |
| InChI | InChI=1S/C14H14FN3O2S/c1-2-8-5-6-21-12(8)14(19)17-9-3-4-11(15)10(7-9)13(16)18-20/h3-7,20H,2H2,1H3,(H2,16,18)(H,17,19) |
| InChIKey | ZMIAKMOIIZDGHH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|