C12H13F3N2O2 — CID 77099417
4,4,4-trifluoro-N-[4-(N-hydroxy-C-methylcarbonimidoyl)phenyl]butanamide (PubChem CID 77099417) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[4-(N-hydroxy-C-methylcarbonimidoyl)phenyl]butanamide.
| Compound Name | 4,4,4-trifluoro-N-[4-(N-hydroxy-C-methylcarbonimidoyl)phenyl]butanamide |
|---|---|
| PubChem CID | 77099417 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 4,4,4-trifluoro-N-[4-(N-hydroxy-C-methylcarbonimidoyl)phenyl]butanamide |
| SMILES | CC(=NO)c1ccc(NC(=O)CCC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F3N2O2/c1-8(17-19)9-2-4-10(5-3-9)16-11(18)6-7-12(13,14)15/h2-5,19H,6-7H2,1H3,(H,16,18) |
| InChIKey | FLPCATPTGRXZSI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|