C21H22ClN3O3 — CID 56968621
1-[(E)-[(E)-1-(1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-ylidene]amino]-3-(4-chlorophenyl)urea (PubChem CID 56968621) has the molecular formula C21H22ClN3O3 and a molecular weight of 399.88 g/mol. Its IUPAC name is 1-[(E)-[(E)-1-(1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-ylidene]amino]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[(E)-[(E)-1-(1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-ylidene]amino]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 56968621 |
| Molecular Formula | C21H22ClN3O3 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 1-[(E)-[(E)-1-(1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-ylidene]amino]-3-(4-chlorophenyl)urea |
| SMILES | CC(C)(C)C(/C=C/c1ccc2c(c1)OCO2)=N/NC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClN3O3/c1-21(2,3)19(11-5-14-4-10-17-18(12-14)28-13-27-17)24-25-20(26)23-16-8-6-15(22)7-9-16/h4-12H,13H2,1-3H3,(H2,23,25,26)/b11-5+,24-19+ |
| InChIKey | YWJFQACPHPXPPZ-XYPKPTLHSA-N |
| XLogP | 5.31 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|