C18H15FN2O3 — CID 726709
N-[4-(1,3-benzodioxol-5-yl)but-3-en-2-ylideneamino]-2-fluorobenzamide (PubChem CID 726709) has the molecular formula C18H15FN2O3 and a molecular weight of 326.33 g/mol. Its IUPAC name is N-[4-(1,3-benzodioxol-5-yl)but-3-en-2-ylideneamino]-2-fluorobenzamide.
| Compound Name | N-[4-(1,3-benzodioxol-5-yl)but-3-en-2-ylideneamino]-2-fluorobenzamide |
|---|---|
| PubChem CID | 726709 |
| Molecular Formula | C18H15FN2O3 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | N-[4-(1,3-benzodioxol-5-yl)but-3-en-2-ylideneamino]-2-fluorobenzamide |
| SMILES | CC(C=Cc1ccc2c(c1)OCO2)=NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C18H15FN2O3/c1-12(20-21-18(22)14-4-2-3-5-15(14)19)6-7-13-8-9-16-17(10-13)24-11-23-16/h2-10H,11H2,1H3,(H,21,22) |
| InChIKey | LSGCSFKEPLDROJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|