C19H22N4O3 — CID 1275805
N-[[(E)-4-(1,3-benzodioxol-5-yl)but-3-en-2-ylidene]amino]-5-tert-butyl-1H-pyrazole-3-carboxamide (PubChem CID 1275805) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[[(E)-4-(1,3-benzodioxol-5-yl)but-3-en-2-ylidene]amino]-5-tert-butyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-[[(E)-4-(1,3-benzodioxol-5-yl)but-3-en-2-ylidene]amino]-5-tert-butyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 1275805 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-[[(E)-4-(1,3-benzodioxol-5-yl)but-3-en-2-ylidene]amino]-5-tert-butyl-1H-pyrazole-3-carboxamide |
| SMILES | CC(/C=C/c1ccc2c(c1)OCO2)=NNC(=O)c1cc(C(C)(C)C)[nH]n1 |
| InChI | InChI=1S/C19H22N4O3/c1-12(5-6-13-7-8-15-16(9-13)26-11-25-15)20-23-18(24)14-10-17(22-21-14)19(2,3)4/h5-10H,11H2,1-4H3,(H,21,22)(H,23,24)/b6-5+,20-12? |
| InChIKey | BBAGLFJHRGVVDB-CLPMHEOYSA-N |
| XLogP | 3.26 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|