C18H20N4O3 — CID 5127333
N-[3-(1,3-benzodioxol-5-yl)prop-2-enylideneamino]-5-tert-butyl-1H-pyrazole-3-carboxamide (PubChem CID 5127333) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-[3-(1,3-benzodioxol-5-yl)prop-2-enylideneamino]-5-tert-butyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-[3-(1,3-benzodioxol-5-yl)prop-2-enylideneamino]-5-tert-butyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 5127333 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-[3-(1,3-benzodioxol-5-yl)prop-2-enylideneamino]-5-tert-butyl-1H-pyrazole-3-carboxamide |
| SMILES | CC(C)(C)c1cc(C(=O)NN=CC=Cc2ccc3c(c2)OCO3)n[nH]1 |
| InChI | InChI=1S/C18H20N4O3/c1-18(2,3)16-10-13(20-21-16)17(23)22-19-8-4-5-12-6-7-14-15(9-12)25-11-24-14/h4-10H,11H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | QADXGUXNFJHECG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|