C17H13ClN2O4 — CID 126456997
N-[(E)-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enylidene]amino]-5-chloro-2-hydroxybenzamide (PubChem CID 126456997) has the molecular formula C17H13ClN2O4 and a molecular weight of 344.75 g/mol. Its IUPAC name is N-[(E)-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enylidene]amino]-5-chloro-2-hydroxybenzamide.
| Compound Name | N-[(E)-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enylidene]amino]-5-chloro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 126456997 |
| Molecular Formula | C17H13ClN2O4 |
| Molecular Weight | 344.75 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | N-[(E)-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enylidene]amino]-5-chloro-2-hydroxybenzamide |
| SMILES | O=C(N/N=C/C=C/c1ccc2c(c1)OCO2)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C17H13ClN2O4/c18-12-4-5-14(21)13(9-12)17(22)20-19-7-1-2-11-3-6-15-16(8-11)24-10-23-15/h1-9,21H,10H2,(H,20,22)/b2-1+,19-7+ |
| InChIKey | LHNDZIULPNOFQY-HVCOGCEVSA-N |
| XLogP | 3.20 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.75 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|