C22H19N3O3 — CID 129441391
N-[[(E)-4-(1,3-benzodioxol-5-yl)but-3-en-2-ylidene]amino]-2-pyrrol-1-ylbenzamide (PubChem CID 129441391) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is N-[[(E)-4-(1,3-benzodioxol-5-yl)but-3-en-2-ylidene]amino]-2-pyrrol-1-ylbenzamide.
| Compound Name | N-[[(E)-4-(1,3-benzodioxol-5-yl)but-3-en-2-ylidene]amino]-2-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 129441391 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | N-[[(E)-4-(1,3-benzodioxol-5-yl)but-3-en-2-ylidene]amino]-2-pyrrol-1-ylbenzamide |
| SMILES | CC(/C=C/c1ccc2c(c1)OCO2)=NNC(=O)c1ccccc1-n1cccc1 |
| InChI | InChI=1S/C22H19N3O3/c1-16(8-9-17-10-11-20-21(14-17)28-15-27-20)23-24-22(26)18-6-2-3-7-19(18)25-12-4-5-13-25/h2-14H,15H2,1H3,(H,24,26)/b9-8+,23-16? |
| InChIKey | ZGPHXYNBZDLLSL-IVBIPYPVSA-N |
| XLogP | 4.03 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|