C37H51Cl3N6O — CID 6519178
1,3-bis[(Z)-[(E)-1-(4-chlorophenyl)-4,4-dimethyl-5-piperidin-1-ylpent-1-en-3-ylidene]amino]urea;hydrochloride (PubChem CID 6519178) has the molecular formula C37H51Cl3N6O and a molecular weight of 702.22 g/mol. Its IUPAC name is 1,3-bis[(Z)-[(E)-1-(4-chlorophenyl)-4,4-dimethyl-5-piperidin-1-ylpent-1-en-3-ylidene]amino]urea;hydrochloride.
| Compound Name | 1,3-bis[(Z)-[(E)-1-(4-chlorophenyl)-4,4-dimethyl-5-piperidin-1-ylpent-1-en-3-ylidene]amino]urea;hydrochloride |
|---|---|
| PubChem CID | 6519178 |
| Molecular Formula | C37H51Cl3N6O |
| Molecular Weight | 702.22 g/mol |
| Exact Mass | 700.32 |
| IUPAC Name | 1,3-bis[(Z)-[(E)-1-(4-chlorophenyl)-4,4-dimethyl-5-piperidin-1-ylpent-1-en-3-ylidene]amino]urea;hydrochloride |
| SMILES | CC(C)(CN1CCCCC1)C(/C=C/c1ccc(Cl)cc1)=N\NC(=O)N/N=C(/C=C/c1ccc(Cl)cc1)C(C)(C)CN1CCCCC1.Cl |
| InChI | InChI=1S/C37H50Cl2N6O.ClH/c1-36(2,27-44-23-7-5-8-24-44)33(21-15-29-11-17-31(38)18-12-29)40-42-35(46)43-41-34(22-16-30-13-19-32(39)20-14-30)37(3,4)28-45-25-9-6-10-26-45;/h11-22H,5-10,23-28H2,1-4H3,(H2,42,43,46);1H/b21-15+,22-16+,40-33-,41-34-; |
| InChIKey | VUKIXGDYBZEWSX-WBBKZSMVSA-N |
| XLogP | 9.18 |
| TPSA | 72.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.22 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|