C39H56N6O — CID 98560400
1,3-bis[(Z)-[(Z)-4,4-dimethyl-1-(4-methylphenyl)-5-piperidin-1-ylpent-1-en-3-ylidene]amino]urea (PubChem CID 98560400) has the molecular formula C39H56N6O and a molecular weight of 624.92 g/mol. Its IUPAC name is 1,3-bis[(Z)-[(Z)-4,4-dimethyl-1-(4-methylphenyl)-5-piperidin-1-ylpent-1-en-3-ylidene]amino]urea.
| Compound Name | 1,3-bis[(Z)-[(Z)-4,4-dimethyl-1-(4-methylphenyl)-5-piperidin-1-ylpent-1-en-3-ylidene]amino]urea |
|---|---|
| PubChem CID | 98560400 |
| Molecular Formula | C39H56N6O |
| Molecular Weight | 624.92 g/mol |
| Exact Mass | 624.45 |
| IUPAC Name | 1,3-bis[(Z)-[(Z)-4,4-dimethyl-1-(4-methylphenyl)-5-piperidin-1-ylpent-1-en-3-ylidene]amino]urea |
| SMILES | Cc1ccc(/C=C\C(=N\NC(=O)N/N=C(/C=C\c2ccc(C)cc2)C(C)(C)CN2CCCCC2)C(C)(C)CN2CCCCC2)cc1 |
| InChI | InChI=1S/C39H56N6O/c1-31-13-17-33(18-14-31)21-23-35(38(3,4)29-44-25-9-7-10-26-44)40-42-37(46)43-41-36(24-22-34-19-15-32(2)16-20-34)39(5,6)30-45-27-11-8-12-28-45/h13-24H,7-12,25-30H2,1-6H3,(H2,42,43,46)/b23-21-,24-22-,40-35-,41-36- |
| InChIKey | YDXSFKJPBVDNEE-FLACSBHQSA-N |
| XLogP | 8.07 |
| TPSA | 72.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.92 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|