C19H28ClNO2 — CID 6474494
(E)-1-(4-methoxyphenyl)-4,4-dimethyl-5-piperidin-1-ylpent-1-en-3-one;hydrochloride (PubChem CID 6474494) has the molecular formula C19H28ClNO2 and a molecular weight of 337.89 g/mol. Its IUPAC name is (E)-1-(4-methoxyphenyl)-4,4-dimethyl-5-piperidin-1-ylpent-1-en-3-one;hydrochloride.
| Compound Name | (E)-1-(4-methoxyphenyl)-4,4-dimethyl-5-piperidin-1-ylpent-1-en-3-one;hydrochloride |
|---|---|
| PubChem CID | 6474494 |
| Molecular Formula | C19H28ClNO2 |
| Molecular Weight | 337.89 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | (E)-1-(4-methoxyphenyl)-4,4-dimethyl-5-piperidin-1-ylpent-1-en-3-one;hydrochloride |
| SMILES | COc1ccc(/C=C/C(=O)C(C)(C)CN2CCCCC2)cc1.Cl |
| InChI | InChI=1S/C19H27NO2.ClH/c1-19(2,15-20-13-5-4-6-14-20)18(21)12-9-16-7-10-17(22-3)11-8-16;/h7-12H,4-6,13-15H2,1-3H3;1H/b12-9+; |
| InChIKey | ZBJYOBKCXSSIRU-NBYYMMLRSA-N |
| XLogP | 4.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.89 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|