C19H27NO — CID 92531025
(Z)-4,4-dimethyl-1-(4-methylphenyl)-5-piperidin-1-ylpent-1-en-3-one (PubChem CID 92531025) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is (Z)-4,4-dimethyl-1-(4-methylphenyl)-5-piperidin-1-ylpent-1-en-3-one.
| Compound Name | (Z)-4,4-dimethyl-1-(4-methylphenyl)-5-piperidin-1-ylpent-1-en-3-one |
|---|---|
| PubChem CID | 92531025 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | (Z)-4,4-dimethyl-1-(4-methylphenyl)-5-piperidin-1-ylpent-1-en-3-one |
| SMILES | Cc1ccc(/C=C\C(=O)C(C)(C)CN2CCCCC2)cc1 |
| InChI | InChI=1S/C19H27NO/c1-16-7-9-17(10-8-16)11-12-18(21)19(2,3)15-20-13-5-4-6-14-20/h7-12H,4-6,13-15H2,1-3H3/b12-11- |
| InChIKey | DMJPCCYONRHOHM-QXMHVHEDSA-N |
| XLogP | 4.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|