C20H27Cl2N3O3S — CID 66999132
3-(3,4-dichlorophenyl)-1-[1,1-dioxo-2-(3-piperidin-1-ylpropyl)-1,2,5-thiadiazinan-5-yl]prop-2-en-1-one (PubChem CID 66999132) has the molecular formula C20H27Cl2N3O3S and a molecular weight of 460.43 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-[1,1-dioxo-2-(3-piperidin-1-ylpropyl)-1,2,5-thiadiazinan-5-yl]prop-2-en-1-one.
| Compound Name | 3-(3,4-dichlorophenyl)-1-[1,1-dioxo-2-(3-piperidin-1-ylpropyl)-1,2,5-thiadiazinan-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 66999132 |
| Molecular Formula | C20H27Cl2N3O3S |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-[1,1-dioxo-2-(3-piperidin-1-ylpropyl)-1,2,5-thiadiazinan-5-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(Cl)c(Cl)c1)N1CCN(CCCN2CCCCC2)S(=O)(=O)C1 |
| InChI | InChI=1S/C20H27Cl2N3O3S/c21-18-7-5-17(15-19(18)22)6-8-20(26)24-13-14-25(29(27,28)16-24)12-4-11-23-9-2-1-3-10-23/h5-8,15H,1-4,9-14,16H2 |
| InChIKey | PYKACPKMFNESTF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|