C22H27Cl2N3O3 — CID 123641155
1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[3-(3-oxopiperidin-1-yl)propyl]-1,4-diazepan-5-one (PubChem CID 123641155) has the molecular formula C22H27Cl2N3O3 and a molecular weight of 452.38 g/mol. Its IUPAC name is 1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[3-(3-oxopiperidin-1-yl)propyl]-1,4-diazepan-5-one.
| Compound Name | 1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[3-(3-oxopiperidin-1-yl)propyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 123641155 |
| Molecular Formula | C22H27Cl2N3O3 |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[3-(3-oxopiperidin-1-yl)propyl]-1,4-diazepan-5-one |
| SMILES | O=C1CCCN(CCCN2CCN(C(=O)C=Cc3ccc(Cl)c(Cl)c3)CCC2=O)C1 |
| InChI | InChI=1S/C22H27Cl2N3O3/c23-19-6-4-17(15-20(19)24)5-7-21(29)27-12-8-22(30)26(13-14-27)11-2-10-25-9-1-3-18(28)16-25/h4-7,15H,1-3,8-14,16H2 |
| InChIKey | YWIYXJCQBPEEJQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|