C23H31Cl2N3O3 — CID 90884070
1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[3-[(2R,3R)-3-hydroxy-2-methylpiperidin-1-yl]propyl]-1,4-diazepan-5-one (PubChem CID 90884070) has the molecular formula C23H31Cl2N3O3 and a molecular weight of 468.43 g/mol. Its IUPAC name is 1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[3-[(2R,3R)-3-hydroxy-2-methylpiperidin-1-yl]propyl]-1,4-diazepan-5-one.
| Compound Name | 1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[3-[(2R,3R)-3-hydroxy-2-methylpiperidin-1-yl]propyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 90884070 |
| Molecular Formula | C23H31Cl2N3O3 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[3-[(2R,3R)-3-hydroxy-2-methylpiperidin-1-yl]propyl]-1,4-diazepan-5-one |
| SMILES | C[C@@H]1[C@H](O)CCCN1CCCN1CCN(C(=O)C=Cc2ccc(Cl)c(Cl)c2)CCC1=O |
| InChI | InChI=1S/C23H31Cl2N3O3/c1-17-21(29)4-2-10-26(17)11-3-12-27-14-15-28(13-9-23(27)31)22(30)8-6-18-5-7-19(24)20(25)16-18/h5-8,16-17,21,29H,2-4,9-15H2,1H3/t17-,21-/m1/s1 |
| InChIKey | GSPQTWWSTRYGMB-DYESRHJHSA-N |
| XLogP | 3.30 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|