C24H33ClFN3O3 — CID 91198842
1-[3-(3-chloro-4-fluorophenyl)prop-2-enoyl]-4-[4-[(3R,5S)-3-hydroxy-5-methylpiperidin-1-yl]butyl]-1,4-diazepan-5-one (PubChem CID 91198842) has the molecular formula C24H33ClFN3O3 and a molecular weight of 466.00 g/mol. Its IUPAC name is 1-[3-(3-chloro-4-fluorophenyl)prop-2-enoyl]-4-[4-[(3R,5S)-3-hydroxy-5-methylpiperidin-1-yl]butyl]-1,4-diazepan-5-one.
| Compound Name | 1-[3-(3-chloro-4-fluorophenyl)prop-2-enoyl]-4-[4-[(3R,5S)-3-hydroxy-5-methylpiperidin-1-yl]butyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 91198842 |
| Molecular Formula | C24H33ClFN3O3 |
| Molecular Weight | 466.00 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 1-[3-(3-chloro-4-fluorophenyl)prop-2-enoyl]-4-[4-[(3R,5S)-3-hydroxy-5-methylpiperidin-1-yl]butyl]-1,4-diazepan-5-one |
| SMILES | C[C@H]1C[C@@H](O)CN(CCCCN2CCN(C(=O)C=Cc3ccc(F)c(Cl)c3)CCC2=O)C1 |
| InChI | InChI=1S/C24H33ClFN3O3/c1-18-14-20(30)17-27(16-18)9-2-3-10-28-12-13-29(11-8-24(28)32)23(31)7-5-19-4-6-22(26)21(25)15-19/h4-7,15,18,20,30H,2-3,8-14,16-17H2,1H3/t18-,20+/m0/s1 |
| InChIKey | JIYDUWALVLGIDY-AZUAARDMSA-N |
| XLogP | 3.04 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.00 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|