C16H18F2N2O2 — CID 26317705
1-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]-4-ethyl-1,4-diazepan-5-one (PubChem CID 26317705) has the molecular formula C16H18F2N2O2 and a molecular weight of 308.33 g/mol. Its IUPAC name is 1-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]-4-ethyl-1,4-diazepan-5-one.
| Compound Name | 1-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]-4-ethyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 26317705 |
| Molecular Formula | C16H18F2N2O2 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]-4-ethyl-1,4-diazepan-5-one |
| SMILES | CCN1CCN(C(=O)/C=C/c2cc(F)cc(F)c2)CCC1=O |
| InChI | InChI=1S/C16H18F2N2O2/c1-2-19-7-8-20(6-5-16(19)22)15(21)4-3-12-9-13(17)11-14(18)10-12/h3-4,9-11H,2,5-8H2,1H3/b4-3+ |
| InChIKey | VZFXEQTYXKXNHI-ONEGZZNKSA-N |
| XLogP | 2.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|