C19H22Cl2N2O4 — CID 67074853
ethyl 3-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-7-oxo-1,4-diazepan-1-yl]propanoate (PubChem CID 67074853) has the molecular formula C19H22Cl2N2O4 and a molecular weight of 413.30 g/mol. Its IUPAC name is ethyl 3-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-7-oxo-1,4-diazepan-1-yl]propanoate.
| Compound Name | ethyl 3-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-7-oxo-1,4-diazepan-1-yl]propanoate |
|---|---|
| PubChem CID | 67074853 |
| Molecular Formula | C19H22Cl2N2O4 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | ethyl 3-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-7-oxo-1,4-diazepan-1-yl]propanoate |
| SMILES | CCOC(=O)CCN1CCN(C(=O)/C=C/c2ccc(Cl)c(Cl)c2)CCC1=O |
| InChI | InChI=1S/C19H22Cl2N2O4/c1-2-27-19(26)8-10-23-12-11-22(9-7-18(23)25)17(24)6-4-14-3-5-15(20)16(21)13-14/h3-6,13H,2,7-12H2,1H3/b6-4+ |
| InChIKey | IXXVHGVJWFWKGD-GQCTYLIASA-N |
| XLogP | 3.02 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|