C26H37Cl2N3O5 — CID 77498754
1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[4-(3-hydroxy-2,6-dimethoxy-2-methylpiperidin-1-yl)butyl]-1,4-diazepan-5-one (PubChem CID 77498754) has the molecular formula C26H37Cl2N3O5 and a molecular weight of 542.50 g/mol. Its IUPAC name is 1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[4-(3-hydroxy-2,6-dimethoxy-2-methylpiperidin-1-yl)butyl]-1,4-diazepan-5-one.
| Compound Name | 1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[4-(3-hydroxy-2,6-dimethoxy-2-methylpiperidin-1-yl)butyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 77498754 |
| Molecular Formula | C26H37Cl2N3O5 |
| Molecular Weight | 542.50 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | 1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[4-(3-hydroxy-2,6-dimethoxy-2-methylpiperidin-1-yl)butyl]-1,4-diazepan-5-one |
| SMILES | COC1CCC(O)C(C)(OC)N1CCCCN1CCN(C(=O)C=Cc2ccc(Cl)c(Cl)c2)CCC1=O |
| InChI | InChI=1S/C26H37Cl2N3O5/c1-26(36-3)22(32)9-11-25(35-2)31(26)14-5-4-13-29-16-17-30(15-12-24(29)34)23(33)10-7-19-6-8-20(27)21(28)18-19/h6-8,10,18,22,25,32H,4-5,9,11-17H2,1-3H3 |
| InChIKey | VUGWGTMNFUKYGU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|