C23H31Cl2N3O4 — CID 91118921
1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[2-[[(3R,4R)-3-methoxyoxan-4-yl]-methylamino]ethyl]-1,4-diazepan-5-one (PubChem CID 91118921) has the molecular formula C23H31Cl2N3O4 and a molecular weight of 484.42 g/mol. Its IUPAC name is 1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[2-[[(3R,4R)-3-methoxyoxan-4-yl]-methylamino]ethyl]-1,4-diazepan-5-one.
| Compound Name | 1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[2-[[(3R,4R)-3-methoxyoxan-4-yl]-methylamino]ethyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 91118921 |
| Molecular Formula | C23H31Cl2N3O4 |
| Molecular Weight | 484.42 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[2-[[(3R,4R)-3-methoxyoxan-4-yl]-methylamino]ethyl]-1,4-diazepan-5-one |
| SMILES | CO[C@H]1COCC[C@H]1N(C)CCN1CCN(C(=O)C=Cc2ccc(Cl)c(Cl)c2)CCC1=O |
| InChI | InChI=1S/C23H31Cl2N3O4/c1-26(20-8-14-32-16-21(20)31-2)10-11-28-13-12-27(9-7-23(28)30)22(29)6-4-17-3-5-18(24)19(25)15-17/h3-6,15,20-21H,7-14,16H2,1-2H3/t20-,21+/m1/s1 |
| InChIKey | VHGOPZACKZWTSV-RTWAWAEBSA-N |
| XLogP | 2.80 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|