C18H18Cl2N2O4 — CID 67074246
1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-(2-oxooxolan-3-yl)-1,4-diazepan-5-one (PubChem CID 67074246) has the molecular formula C18H18Cl2N2O4 and a molecular weight of 397.26 g/mol. Its IUPAC name is 1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-(2-oxooxolan-3-yl)-1,4-diazepan-5-one.
| Compound Name | 1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-(2-oxooxolan-3-yl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 67074246 |
| Molecular Formula | C18H18Cl2N2O4 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-(2-oxooxolan-3-yl)-1,4-diazepan-5-one |
| SMILES | O=C1OCCC1N1CCN(C(=O)C=Cc2ccc(Cl)c(Cl)c2)CCC1=O |
| InChI | InChI=1S/C18H18Cl2N2O4/c19-13-3-1-12(11-14(13)20)2-4-16(23)21-7-5-17(24)22(9-8-21)15-6-10-26-18(15)25/h1-4,11,15H,5-10H2 |
| InChIKey | SAXIQCMTXJWCIK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|