C22H27Cl2N3O4 — CID 67087261
1-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[3-(3-hydroxypiperidin-1-yl)-3-oxopropyl]-1,4-diazepan-5-one (PubChem CID 67087261) has the molecular formula C22H27Cl2N3O4 and a molecular weight of 468.38 g/mol. Its IUPAC name is 1-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[3-(3-hydroxypiperidin-1-yl)-3-oxopropyl]-1,4-diazepan-5-one.
| Compound Name | 1-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[3-(3-hydroxypiperidin-1-yl)-3-oxopropyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 67087261 |
| Molecular Formula | C22H27Cl2N3O4 |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 1-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[3-(3-hydroxypiperidin-1-yl)-3-oxopropyl]-1,4-diazepan-5-one |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)N1CCC(=O)N(CCC(=O)N2CCCC(O)C2)CC1 |
| InChI | InChI=1S/C22H27Cl2N3O4/c23-18-5-3-16(14-19(18)24)4-6-20(29)25-10-7-21(30)26(13-12-25)11-8-22(31)27-9-1-2-17(28)15-27/h3-6,14,17,28H,1-2,7-13,15H2/b6-4+ |
| InChIKey | RXAAAFWZDAHOIJ-GQCTYLIASA-N |
| XLogP | 2.44 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|