C24H33Cl2N3O4 — CID 77498812
1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[3-hydroxy-4-[4-(hydroxymethyl)piperidin-1-yl]butyl]-1,4-diazepan-5-one (PubChem CID 77498812) has the molecular formula C24H33Cl2N3O4 and a molecular weight of 498.45 g/mol. Its IUPAC name is 1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[3-hydroxy-4-[4-(hydroxymethyl)piperidin-1-yl]butyl]-1,4-diazepan-5-one.
| Compound Name | 1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[3-hydroxy-4-[4-(hydroxymethyl)piperidin-1-yl]butyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 77498812 |
| Molecular Formula | C24H33Cl2N3O4 |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[3-hydroxy-4-[4-(hydroxymethyl)piperidin-1-yl]butyl]-1,4-diazepan-5-one |
| SMILES | O=C(C=Cc1ccc(Cl)c(Cl)c1)N1CCC(=O)N(CCC(O)CN2CCC(CO)CC2)CC1 |
| InChI | InChI=1S/C24H33Cl2N3O4/c25-21-3-1-18(15-22(21)26)2-4-23(32)29-12-8-24(33)28(13-14-29)11-7-20(31)16-27-9-5-19(17-30)6-10-27/h1-4,15,19-20,30-31H,5-14,16-17H2 |
| InChIKey | MVMIAAPREIIWIV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|