C25H35Cl2N3O3 — CID 77498490
1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[4-[4-(hydroxymethyl)-4-methylpiperidin-1-yl]butyl]-1,4-diazepan-5-one (PubChem CID 77498490) has the molecular formula C25H35Cl2N3O3 and a molecular weight of 496.48 g/mol. Its IUPAC name is 1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[4-[4-(hydroxymethyl)-4-methylpiperidin-1-yl]butyl]-1,4-diazepan-5-one.
| Compound Name | 1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[4-[4-(hydroxymethyl)-4-methylpiperidin-1-yl]butyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 77498490 |
| Molecular Formula | C25H35Cl2N3O3 |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-[4-[4-(hydroxymethyl)-4-methylpiperidin-1-yl]butyl]-1,4-diazepan-5-one |
| SMILES | CC1(CO)CCN(CCCCN2CCN(C(=O)C=Cc3ccc(Cl)c(Cl)c3)CCC2=O)CC1 |
| InChI | InChI=1S/C25H35Cl2N3O3/c1-25(19-31)9-14-28(15-10-25)11-2-3-12-29-16-17-30(13-8-24(29)33)23(32)7-5-20-4-6-21(26)22(27)18-20/h4-7,18,31H,2-3,8-17,19H2,1H3 |
| InChIKey | QSHLIWYVLKELMH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|