C22H29ClFN3O2 — CID 25032088
1-[(E)-3-(3-chloro-4-fluorophenyl)prop-2-enoyl]-4-(3-piperidin-1-ylpropyl)-1,4-diazepan-5-one (PubChem CID 25032088) has the molecular formula C22H29ClFN3O2 and a molecular weight of 421.94 g/mol. Its IUPAC name is 1-[(E)-3-(3-chloro-4-fluorophenyl)prop-2-enoyl]-4-(3-piperidin-1-ylpropyl)-1,4-diazepan-5-one.
| Compound Name | 1-[(E)-3-(3-chloro-4-fluorophenyl)prop-2-enoyl]-4-(3-piperidin-1-ylpropyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 25032088 |
| Molecular Formula | C22H29ClFN3O2 |
| Molecular Weight | 421.94 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 1-[(E)-3-(3-chloro-4-fluorophenyl)prop-2-enoyl]-4-(3-piperidin-1-ylpropyl)-1,4-diazepan-5-one |
| SMILES | O=C(/C=C/c1ccc(F)c(Cl)c1)N1CCC(=O)N(CCCN2CCCCC2)CC1 |
| InChI | InChI=1S/C22H29ClFN3O2/c23-19-17-18(5-7-20(19)24)6-8-21(28)27-14-9-22(29)26(15-16-27)13-4-12-25-10-2-1-3-11-25/h5-8,17H,1-4,9-16H2/b8-6+ |
| InChIKey | PGMQDAFYFJYKJD-SOFGYWHQSA-N |
| XLogP | 3.43 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.94 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|