C22H22Cl2N2O4 — CID 33173404
(E)-3-(3,4-dichlorophenyl)-1-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 33173404) has the molecular formula C22H22Cl2N2O4 and a molecular weight of 449.33 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-1-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-1-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 33173404 |
| Molecular Formula | C22H22Cl2N2O4 |
| Molecular Weight | 449.33 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-1-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | COc1cc(OC)cc(C(=O)N2CCN(C(=O)/C=C/c3ccc(Cl)c(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C22H22Cl2N2O4/c1-29-17-12-16(13-18(14-17)30-2)22(28)26-9-7-25(8-10-26)21(27)6-4-15-3-5-19(23)20(24)11-15/h3-6,11-14H,7-10H2,1-2H3/b6-4+ |
| InChIKey | RAJWHJNUSMZSIM-GQCTYLIASA-N |
| XLogP | 4.01 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|