C19H20ClN4OS+ — CID 9181253
(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one (PubChem CID 9181253) has the molecular formula C19H20ClN4OS+ and a molecular weight of 387.92 g/mol. Its IUPAC name is (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 9181253 |
| Molecular Formula | C19H20ClN4OS+ |
| Molecular Weight | 387.92 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1c(Cl)nc2ccccn12)N1CC[NH+](Cc2ccsc2)CC1 |
| InChI | InChI=1S/C19H19ClN4OS/c20-19-16(24-7-2-1-3-17(24)21-19)4-5-18(25)23-10-8-22(9-11-23)13-15-6-12-26-14-15/h1-7,12,14H,8-11,13H2/p+1/b5-4+ |
| InChIKey | HOFYJJYOZICFOE-SNAWJCMRSA-O |
| XLogP | 1.99 |
| TPSA | 42.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.92 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|