C19H16ClN3O — CID 6212485
(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1-(3,4-dihydro-1H-isoquinolin-2-yl)prop-2-en-1-one (PubChem CID 6212485) has the molecular formula C19H16ClN3O and a molecular weight of 337.81 g/mol. Its IUPAC name is (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1-(3,4-dihydro-1H-isoquinolin-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1-(3,4-dihydro-1H-isoquinolin-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6212485 |
| Molecular Formula | C19H16ClN3O |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1-(3,4-dihydro-1H-isoquinolin-2-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1c(Cl)nc2ccccn12)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H16ClN3O/c20-19-16(23-11-4-3-7-17(23)21-19)8-9-18(24)22-12-10-14-5-1-2-6-15(14)13-22/h1-9,11H,10,12-13H2/b9-8+ |
| InChIKey | IILJROVPYCXZGC-CMDGGOBGSA-N |
| XLogP | 3.59 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|