C23H22ClN7O — CID 37131928
(E)-1-[4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-en-1-one (PubChem CID 37131928) has the molecular formula C23H22ClN7O and a molecular weight of 447.93 g/mol. Its IUPAC name is (E)-1-[4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 37131928 |
| Molecular Formula | C23H22ClN7O |
| Molecular Weight | 447.93 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | (E)-1-[4-[(4-aminoquinazolin-2-yl)methyl]piperazin-1-yl]-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-en-1-one |
| SMILES | Nc1nc(CN2CCN(C(=O)/C=C/c3c(Cl)nc4ccccn34)CC2)nc2ccccc12 |
| InChI | InChI=1S/C23H22ClN7O/c24-22-18(31-10-4-3-7-20(31)28-22)8-9-21(32)30-13-11-29(12-14-30)15-19-26-17-6-2-1-5-16(17)23(25)27-19/h1-10H,11-15H2,(H2,25,26,27)/b9-8+ |
| InChIKey | SEIAFVDTILVOFB-CMDGGOBGSA-N |
| XLogP | 2.87 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.93 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|