C21H18ClN5O3S — CID 27330186
4-[4-[(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoyl]piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 27330186) has the molecular formula C21H18ClN5O3S and a molecular weight of 455.93 g/mol. Its IUPAC name is 4-[4-[(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoyl]piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 4-[4-[(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoyl]piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 27330186 |
| Molecular Formula | C21H18ClN5O3S |
| Molecular Weight | 455.93 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | 4-[4-[(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoyl]piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)N2CCN(C(=O)/C=C/c3c(Cl)nc4ccccn34)CC2)cc1 |
| InChI | InChI=1S/C21H18ClN5O3S/c22-21-18(27-10-2-1-3-19(27)24-21)8-9-20(28)25-11-13-26(14-12-25)31(29,30)17-6-4-16(15-23)5-7-17/h1-10H,11-14H2/b9-8+ |
| InChIKey | QFORSHWPXOKSON-CMDGGOBGSA-N |
| XLogP | 2.41 |
| TPSA | 98.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.93 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|