C21H21ClN4O3S — CID 26865742
(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 26865742) has the molecular formula C21H21ClN4O3S and a molecular weight of 444.94 g/mol. Its IUPAC name is (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 26865742 |
| Molecular Formula | C21H21ClN4O3S |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)/C=C/c3c(Cl)nc4ccccn34)CC2)cc1 |
| InChI | InChI=1S/C21H21ClN4O3S/c1-16-5-7-17(8-6-16)30(28,29)25-14-12-24(13-15-25)20(27)10-9-18-21(22)23-19-4-2-3-11-26(18)19/h2-11H,12-15H2,1H3/b10-9+ |
| InChIKey | CNSHKLVJJRZYJG-MDZDMXLPSA-N |
| XLogP | 2.84 |
| TPSA | 74.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|