C16H16ClN3O3S — CID 91943274
2-[4-[3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoyl]thiomorpholin-3-yl]acetic acid (PubChem CID 91943274) has the molecular formula C16H16ClN3O3S and a molecular weight of 365.84 g/mol. Its IUPAC name is 2-[4-[3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoyl]thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-[3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoyl]thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 91943274 |
| Molecular Formula | C16H16ClN3O3S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 2-[4-[3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoyl]thiomorpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CSCCN1C(=O)C=Cc1c(Cl)nc2ccccn12 |
| InChI | InChI=1S/C16H16ClN3O3S/c17-16-12(20-6-2-1-3-13(20)18-16)4-5-14(21)19-7-8-24-10-11(19)9-15(22)23/h1-6,11H,7-10H2,(H,22,23) |
| InChIKey | GTZVBZOHVJXHIU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|