C18H16N2O7S — CID 8654503
[2-oxo-2-[[(1S)-1-thiophen-2-ylethyl]amino]ethyl] (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 8654503) has the molecular formula C18H16N2O7S and a molecular weight of 404.40 g/mol. Its IUPAC name is [2-oxo-2-[[(1S)-1-thiophen-2-ylethyl]amino]ethyl] (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-[[(1S)-1-thiophen-2-ylethyl]amino]ethyl] (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8654503 |
| Molecular Formula | C18H16N2O7S |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | [2-oxo-2-[[(1S)-1-thiophen-2-ylethyl]amino]ethyl] (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | C[C@H](NC(=O)COC(=O)/C=C/c1cc2c(cc1[N+](=O)[O-])OCO2)c1cccs1 |
| InChI | InChI=1S/C18H16N2O7S/c1-11(16-3-2-6-28-16)19-17(21)9-25-18(22)5-4-12-7-14-15(27-10-26-14)8-13(12)20(23)24/h2-8,11H,9-10H2,1H3,(H,19,21)/b5-4+/t11-/m0/s1 |
| InChIKey | LVHPTTHWJMPQJF-ZWNMCFTASA-N |
| XLogP | 2.82 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|