C18H12F2N2O7 — CID 24659357
methyl 2,4-difluoro-5-[[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]amino]benzoate (PubChem CID 24659357) has the molecular formula C18H12F2N2O7 and a molecular weight of 406.30 g/mol. Its IUPAC name is methyl 2,4-difluoro-5-[[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]amino]benzoate.
| Compound Name | methyl 2,4-difluoro-5-[[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 24659357 |
| Molecular Formula | C18H12F2N2O7 |
| Molecular Weight | 406.30 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | methyl 2,4-difluoro-5-[[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)/C=C/c2cc3c(cc2[N+](=O)[O-])OCO3)c(F)cc1F |
| InChI | InChI=1S/C18H12F2N2O7/c1-27-18(24)10-5-13(12(20)6-11(10)19)21-17(23)3-2-9-4-15-16(29-8-28-15)7-14(9)22(25)26/h2-7H,8H2,1H3,(H,21,23)/b3-2+ |
| InChIKey | MIXVADJPDTWOJK-NSCUHMNNSA-N |
| XLogP | 3.04 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|