C14H14NO3- — CID 7218047
4-oxo-4-(5,6,7,8-tetrahydronaphthalen-1-ylamino)but-2-enoate (PubChem CID 7218047) has the molecular formula C14H14NO3- and a molecular weight of 244.27 g/mol. Its IUPAC name is 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-1-ylamino)but-2-enoate.
| Compound Name | 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-1-ylamino)but-2-enoate |
|---|---|
| PubChem CID | 7218047 |
| Molecular Formula | C14H14NO3- |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-1-ylamino)but-2-enoate |
| SMILES | O=C([O-])C=CC(=O)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C14H15NO3/c16-13(8-9-14(17)18)15-12-7-3-5-10-4-1-2-6-11(10)12/h3,5,7-9H,1-2,4,6H2,(H,15,16)(H,17,18)/p-1 |
| InChIKey | NWIOLOZYQWUIIL-UHFFFAOYSA-M |
| XLogP | 0.81 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|