C21H22N2O5 — CID 70456889
pyrrolidin-1-yl 2-[[(E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]amino]benzoate (PubChem CID 70456889) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is pyrrolidin-1-yl 2-[[(E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | pyrrolidin-1-yl 2-[[(E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 70456889 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | pyrrolidin-1-yl 2-[[(E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]amino]benzoate |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccccc2C(=O)ON2CCCC2)cc1O |
| InChI | InChI=1S/C21H22N2O5/c1-27-19-10-8-15(14-18(19)24)9-11-20(25)22-17-7-3-2-6-16(17)21(26)28-23-12-4-5-13-23/h2-3,6-11,14,24H,4-5,12-13H2,1H3,(H,22,25)/b11-9+ |
| InChIKey | RBARTDVTRUZIHW-PKNBQFBNSA-N |
| XLogP | 3.22 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|