C28H26F3NO7 — CID 90676914
(E)-N-[2,3-dimethoxy-5-(3,4,5-trimethoxybenzoyl)phenyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 90676914) has the molecular formula C28H26F3NO7 and a molecular weight of 545.51 g/mol. Its IUPAC name is (E)-N-[2,3-dimethoxy-5-(3,4,5-trimethoxybenzoyl)phenyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2,3-dimethoxy-5-(3,4,5-trimethoxybenzoyl)phenyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 90676914 |
| Molecular Formula | C28H26F3NO7 |
| Molecular Weight | 545.51 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | (E)-N-[2,3-dimethoxy-5-(3,4,5-trimethoxybenzoyl)phenyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | COc1cc(C(=O)c2cc(OC)c(OC)c(OC)c2)cc(NC(=O)/C=C/c2ccc(C(F)(F)F)cc2)c1OC |
| InChI | InChI=1S/C28H26F3NO7/c1-35-21-13-17(25(34)18-14-22(36-2)27(39-5)23(15-18)37-3)12-20(26(21)38-4)32-24(33)11-8-16-6-9-19(10-7-16)28(29,30)31/h6-15H,1-5H3,(H,32,33)/b11-8+ |
| InChIKey | FGFAWQRJEPEKJH-DHZHZOJOSA-N |
| XLogP | 5.63 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.51 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|