C25H25BrN2O5 — CID 155523239
1-(3-bromophenyl)-3-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]urea (PubChem CID 155523239) has the molecular formula C25H25BrN2O5 and a molecular weight of 513.39 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]urea.
| Compound Name | 1-(3-bromophenyl)-3-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]urea |
|---|---|
| PubChem CID | 155523239 |
| Molecular Formula | C25H25BrN2O5 |
| Molecular Weight | 513.39 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | 1-(3-bromophenyl)-3-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]urea |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1NC(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C25H25BrN2O5/c1-30-21-11-10-16(8-9-17-13-22(31-2)24(33-4)23(14-17)32-3)12-20(21)28-25(29)27-19-7-5-6-18(26)15-19/h5-15H,1-4H3,(H2,27,28,29)/b9-8- |
| InChIKey | BTIZBIYFMXKPJT-HJWRWDBZSA-N |
| XLogP | 6.30 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.39 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|