C30H29N3O6 — CID 175347336
N-(2-aminophenyl)-6-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]pyridine-3-carboxamide (PubChem CID 175347336) has the molecular formula C30H29N3O6 and a molecular weight of 527.58 g/mol. Its IUPAC name is N-(2-aminophenyl)-6-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]pyridine-3-carboxamide.
| Compound Name | N-(2-aminophenyl)-6-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175347336 |
| Molecular Formula | C30H29N3O6 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | N-(2-aminophenyl)-6-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]pyridine-3-carboxamide |
| SMILES | COc1ccc(C=Cc2cc(OC)c(OC)c(OC)c2)cc1Oc1ccc(C(=O)Nc2ccccc2N)cn1 |
| InChI | InChI=1S/C30H29N3O6/c1-35-24-13-11-19(9-10-20-16-26(36-2)29(38-4)27(17-20)37-3)15-25(24)39-28-14-12-21(18-32-28)30(34)33-23-8-6-5-7-22(23)31/h5-18H,31H2,1-4H3,(H,33,34) |
| InChIKey | LTSKVFZVFFBSPP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 114.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|