C27H30N2O7 — CID 164618694
N-(2-aminophenyl)-4-[2-methoxy-5-(3,4,5-trimethoxybenzoyl)phenoxy]butanamide (PubChem CID 164618694) has the molecular formula C27H30N2O7 and a molecular weight of 494.54 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[2-methoxy-5-(3,4,5-trimethoxybenzoyl)phenoxy]butanamide.
| Compound Name | N-(2-aminophenyl)-4-[2-methoxy-5-(3,4,5-trimethoxybenzoyl)phenoxy]butanamide |
|---|---|
| PubChem CID | 164618694 |
| Molecular Formula | C27H30N2O7 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | N-(2-aminophenyl)-4-[2-methoxy-5-(3,4,5-trimethoxybenzoyl)phenoxy]butanamide |
| SMILES | COc1ccc(C(=O)c2cc(OC)c(OC)c(OC)c2)cc1OCCCC(=O)Nc1ccccc1N |
| InChI | InChI=1S/C27H30N2O7/c1-32-21-12-11-17(26(31)18-15-23(33-2)27(35-4)24(16-18)34-3)14-22(21)36-13-7-10-25(30)29-20-9-6-5-8-19(20)28/h5-6,8-9,11-12,14-16H,7,10,13,28H2,1-4H3,(H,29,30) |
| InChIKey | IXZYNYVHUALVKX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|