C25H26N4O5 — CID 67078706
N-(2-amino-3-pyridinyl)-4-[[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]methyl]benzamide (PubChem CID 67078706) has the molecular formula C25H26N4O5 and a molecular weight of 462.51 g/mol. Its IUPAC name is N-(2-amino-3-pyridinyl)-4-[[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]methyl]benzamide.
| Compound Name | N-(2-amino-3-pyridinyl)-4-[[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]methyl]benzamide |
|---|---|
| PubChem CID | 67078706 |
| Molecular Formula | C25H26N4O5 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | N-(2-amino-3-pyridinyl)-4-[[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]methyl]benzamide |
| SMILES | COc1cc(C=CC(=O)NCc2ccc(C(=O)Nc3cccnc3N)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H26N4O5/c1-32-20-13-17(14-21(33-2)23(20)34-3)8-11-22(30)28-15-16-6-9-18(10-7-16)25(31)29-19-5-4-12-27-24(19)26/h4-14H,15H2,1-3H3,(H2,26,27)(H,28,30)(H,29,31) |
| InChIKey | OKACDKOBTFDYKJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|