C22H23N3O5 — CID 143408158
N-[2-[(2-amino-3-pyridinyl)oxymethyl]phenyl]-3,4,5-trimethoxybenzamide (PubChem CID 143408158) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is N-[2-[(2-amino-3-pyridinyl)oxymethyl]phenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-[(2-amino-3-pyridinyl)oxymethyl]phenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 143408158 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-[2-[(2-amino-3-pyridinyl)oxymethyl]phenyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccccc2COc2cccnc2N)cc(OC)c1OC |
| InChI | InChI=1S/C22H23N3O5/c1-27-18-11-15(12-19(28-2)20(18)29-3)22(26)25-16-8-5-4-7-14(16)13-30-17-9-6-10-24-21(17)23/h4-12H,13H2,1-3H3,(H2,23,24)(H,25,26) |
| InChIKey | FTSAIBQXIZJHTE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|